3-Carboxy-4-fluorophenylboronic acid
Catalog No: FT-0645002
CAS No: 872460-12-3
- Chemical Name: 3-Carboxy-4-fluorophenylboronic acid
- Molecular Formula: C7H6BFO4
- Molecular Weight: 183.93
- InChI Key: DGORTXQWDDXSIQ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BFO4/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,12-13H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 183.930 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 872460-12-3 |
| Bolling_Point: | 412.6±55.0 °C at 760 mmHg |
| Product_Name: | 5-Borono-2-fluorobenzoic acid |
| Melting_Point: | 217-219ºC |
| Flash_Point: | 203.3±31.5 °C |
| MF: | C7H6BFO4 |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 1.23 |
| Flash_Point: | 203.3±31.5 °C |
| Melting_Point: | 217-219ºC |
| FW: | 183.930 |
| PSA: | 77.76000 |
| Exact_Mass: | 184.034317 |
| MF: | C7H6BFO4 |
| Bolling_Point: | 412.6±55.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Refractive_Index: | 1.560 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2931900090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)